C14H15NO3 — CID 146351688
5-methyl-2-(1-phenylmethoxyethyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 146351688) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-methyl-2-(1-phenylmethoxyethyl)-1,3-oxazole-4-carbaldehyde.
| Compound Name | 5-methyl-2-(1-phenylmethoxyethyl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 146351688 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 5-methyl-2-(1-phenylmethoxyethyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | Cc1oc(C(C)OCc2ccccc2)nc1C=O |
| InChI | InChI=1S/C14H15NO3/c1-10-13(8-16)15-14(18-10)11(2)17-9-12-6-4-3-5-7-12/h3-8,11H,9H2,1-2H3 |
| InChIKey | QBZIDJGOKDUHIG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|