C17H21FN6OS — CID 146358785
4-fluoro-5-[6-[1-(methylsulfanylamino)cyclopropyl]-2-morpholin-4-ylpyrimidin-4-yl]pyridin-2-amine (PubChem CID 146358785) has the molecular formula C17H21FN6OS and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-fluoro-5-[6-[1-(methylsulfanylamino)cyclopropyl]-2-morpholin-4-ylpyrimidin-4-yl]pyridin-2-amine.
| Compound Name | 4-fluoro-5-[6-[1-(methylsulfanylamino)cyclopropyl]-2-morpholin-4-ylpyrimidin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 146358785 |
| Molecular Formula | C17H21FN6OS |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-fluoro-5-[6-[1-(methylsulfanylamino)cyclopropyl]-2-morpholin-4-ylpyrimidin-4-yl]pyridin-2-amine |
| SMILES | CSNC1(c2cc(-c3cnc(N)cc3F)nc(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C17H21FN6OS/c1-26-23-17(2-3-17)14-9-13(11-10-20-15(19)8-12(11)18)21-16(22-14)24-4-6-25-7-5-24/h8-10,23H,2-7H2,1H3,(H2,19,20) |
| InChIKey | YSQYGWBGMQNWHY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|