C14H25NO2 — CID 146359586
N-[(2Z)-2-(1-ethoxyethyl)penta-2,4-dienyl]oxan-4-amine (PubChem CID 146359586) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(2Z)-2-(1-ethoxyethyl)penta-2,4-dienyl]oxan-4-amine.
| Compound Name | N-[(2Z)-2-(1-ethoxyethyl)penta-2,4-dienyl]oxan-4-amine |
|---|---|
| PubChem CID | 146359586 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-[(2Z)-2-(1-ethoxyethyl)penta-2,4-dienyl]oxan-4-amine |
| SMILES | C=C/C=C(/CNC1CCOCC1)C(C)OCC |
| InChI | InChI=1S/C14H25NO2/c1-4-6-13(12(3)17-5-2)11-15-14-7-9-16-10-8-14/h4,6,12,14-15H,1,5,7-11H2,2-3H3/b13-6- |
| InChIKey | ADFHFMIGQDOFMB-MLPAPPSSSA-N |
| XLogP | 2.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|