C6H9FN2O — CID 146362107
2-fluoro-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 146362107) has the molecular formula C6H9FN2O and a molecular weight of 144.15 g/mol. Its IUPAC name is 2-fluoro-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | 2-fluoro-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 146362107 |
| Molecular Formula | C6H9FN2O |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-fluoro-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1NC2CCC(F)N1C2 |
| InChI | InChI=1S/C6H9FN2O/c7-5-2-1-4-3-9(5)6(10)8-4/h4-5H,1-3H2,(H,8,10) |
| InChIKey | ASILRNTUVAFEKP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|