C26H27F5N6O6 — CID 146363491
methyl N-[(E,2S)-7-(dimethylamino)-1-[[1-[[6-fluoro-4-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate (PubChem CID 146363491) has the molecular formula C26H27F5N6O6 and a molecular weight of 614.53 g/mol. Its IUPAC name is methyl N-[(E,2S)-7-(dimethylamino)-1-[[1-[[6-fluoro-4-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate.
| Compound Name | methyl N-[(E,2S)-7-(dimethylamino)-1-[[1-[[6-fluoro-4-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 146363491 |
| Molecular Formula | C26H27F5N6O6 |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | methyl N-[(E,2S)-7-(dimethylamino)-1-[[1-[[6-fluoro-4-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](CC/C=C/C(=O)N(C)C)C(=O)Nc1cccn(Cc2nc3c(OC(F)(F)C(F)F)cc(F)cc3[nH]2)c1=O |
| InChI | InChI=1S/C26H27F5N6O6/c1-36(2)20(38)9-5-4-7-15(34-25(41)42-3)22(39)33-16-8-6-10-37(23(16)40)13-19-32-17-11-14(27)12-18(21(17)35-19)43-26(30,31)24(28)29/h5-6,8-12,15,24H,4,7,13H2,1-3H3,(H,32,35)(H,33,39)(H,34,41)/b9-5+/t15-/m0/s1 |
| InChIKey | YPFCHURCIITMQI-BOSPYUDASA-N |
| XLogP | 3.24 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|