C24H25F2N5O6S — CID 146363780
methyl N-[(E,2S)-7-amino-1-[[1-[[7-(2,2-difluoroethoxy)-1,3-benzothiazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate (PubChem CID 146363780) has the molecular formula C24H25F2N5O6S and a molecular weight of 549.56 g/mol. Its IUPAC name is methyl N-[(E,2S)-7-amino-1-[[1-[[7-(2,2-difluoroethoxy)-1,3-benzothiazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate.
| Compound Name | methyl N-[(E,2S)-7-amino-1-[[1-[[7-(2,2-difluoroethoxy)-1,3-benzothiazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 146363780 |
| Molecular Formula | C24H25F2N5O6S |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | methyl N-[(E,2S)-7-amino-1-[[1-[[7-(2,2-difluoroethoxy)-1,3-benzothiazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](CC/C=C/C(N)=O)C(=O)Nc1cccn(Cc2nc3cccc(OCC(F)F)c3s2)c1=O |
| InChI | InChI=1S/C24H25F2N5O6S/c1-36-24(35)30-15(6-2-3-10-19(27)32)22(33)29-16-8-5-11-31(23(16)34)12-20-28-14-7-4-9-17(21(14)38-20)37-13-18(25)26/h3-5,7-11,15,18H,2,6,12-13H2,1H3,(H2,27,32)(H,29,33)(H,30,35)/b10-3+/t15-/m0/s1 |
| InChIKey | OSHFTGVNCFIZBY-GMLHSMKSSA-N |
| XLogP | 2.63 |
| TPSA | 154.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|