C21H21N5O5S — CID 146348358
[7-amino-1-[[1-(1,3-benzothiazol-2-ylmethyl)-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamic acid (PubChem CID 146348358) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is [7-amino-1-[[1-(1,3-benzothiazol-2-ylmethyl)-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamic acid.
| Compound Name | [7-amino-1-[[1-(1,3-benzothiazol-2-ylmethyl)-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146348358 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | [7-amino-1-[[1-(1,3-benzothiazol-2-ylmethyl)-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamic acid |
| SMILES | NC(=O)C=CCCC(NC(=O)O)C(=O)Nc1cccn(Cc2nc3ccccc3s2)c1=O |
| InChI | InChI=1S/C21H21N5O5S/c22-17(27)10-4-2-7-14(25-21(30)31)19(28)24-15-8-5-11-26(20(15)29)12-18-23-13-6-1-3-9-16(13)32-18/h1,3-6,8-11,14,25H,2,7,12H2,(H2,22,27)(H,24,28)(H,30,31) |
| InChIKey | LQHOFLIHSHXSFD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|