C27H31F4N7O5 — CID 146363802
[(E,2S)-7-(dimethylamino)-1-[[1-[[5-fluoro-1-(3,3,3-trifluoropropyl)benzimidazol-2-yl]methyl]-6-oxopyrimidin-5-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146363802) has the molecular formula C27H31F4N7O5 and a molecular weight of 609.58 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1-[[1-[[5-fluoro-1-(3,3,3-trifluoropropyl)benzimidazol-2-yl]methyl]-6-oxopyrimidin-5-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[5-fluoro-1-(3,3,3-trifluoropropyl)benzimidazol-2-yl]methyl]-6-oxopyrimidin-5-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146363802 |
| Molecular Formula | C27H31F4N7O5 |
| Molecular Weight | 609.58 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[5-fluoro-1-(3,3,3-trifluoropropyl)benzimidazol-2-yl]methyl]-6-oxopyrimidin-5-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1cncn(Cc2nc3cc(F)ccc3n2CCC(F)(F)F)c1=O |
| InChI | InChI=1S/C27H31F4N7O5/c1-35(2)23(39)8-6-5-7-21(43-26(42)36(3)4)24(40)34-19-14-32-16-37(25(19)41)15-22-33-18-13-17(28)9-10-20(18)38(22)12-11-27(29,30)31/h6,8-10,13-14,16,21H,5,7,11-12,15H2,1-4H3,(H,34,40)/b8-6+/t21-/m0/s1 |
| InChIKey | GEUFAPISGSUYBZ-PVHVJQTOSA-N |
| XLogP | 3.16 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|