C23H27FN6O3 — CID 170074350
(E)-N-ethyl-N'-[1-[(5-fluoro-1-methylbenzimidazol-2-yl)methyl]-6-oxopyrimidin-5-yl]-N-methylhept-2-enediamide (PubChem CID 170074350) has the molecular formula C23H27FN6O3 and a molecular weight of 454.51 g/mol. Its IUPAC name is (E)-N-ethyl-N'-[1-[(5-fluoro-1-methylbenzimidazol-2-yl)methyl]-6-oxopyrimidin-5-yl]-N-methylhept-2-enediamide.
| Compound Name | (E)-N-ethyl-N'-[1-[(5-fluoro-1-methylbenzimidazol-2-yl)methyl]-6-oxopyrimidin-5-yl]-N-methylhept-2-enediamide |
|---|---|
| PubChem CID | 170074350 |
| Molecular Formula | C23H27FN6O3 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (E)-N-ethyl-N'-[1-[(5-fluoro-1-methylbenzimidazol-2-yl)methyl]-6-oxopyrimidin-5-yl]-N-methylhept-2-enediamide |
| SMILES | CCN(C)C(=O)/C=C/CCCC(=O)Nc1cncn(Cc2nc3cc(F)ccc3n2C)c1=O |
| InChI | InChI=1S/C23H27FN6O3/c1-4-28(2)22(32)9-7-5-6-8-21(31)27-18-13-25-15-30(23(18)33)14-20-26-17-12-16(24)10-11-19(17)29(20)3/h7,9-13,15H,4-6,8,14H2,1-3H3,(H,27,31)/b9-7+ |
| InChIKey | LNLLRKVRNJBPBL-VQHVLOKHSA-N |
| XLogP | 2.46 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|