C22H24FN5O3 — CID 170074907
(E)-N'-[1-[(5-fluoro-1H-indol-2-yl)methyl]-6-oxopyrimidin-5-yl]-N,N-dimethylhept-2-enediamide (PubChem CID 170074907) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is (E)-N'-[1-[(5-fluoro-1H-indol-2-yl)methyl]-6-oxopyrimidin-5-yl]-N,N-dimethylhept-2-enediamide.
| Compound Name | (E)-N'-[1-[(5-fluoro-1H-indol-2-yl)methyl]-6-oxopyrimidin-5-yl]-N,N-dimethylhept-2-enediamide |
|---|---|
| PubChem CID | 170074907 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (E)-N'-[1-[(5-fluoro-1H-indol-2-yl)methyl]-6-oxopyrimidin-5-yl]-N,N-dimethylhept-2-enediamide |
| SMILES | CN(C)C(=O)/C=C/CCCC(=O)Nc1cncn(Cc2cc3cc(F)ccc3[nH]2)c1=O |
| InChI | InChI=1S/C22H24FN5O3/c1-27(2)21(30)7-5-3-4-6-20(29)26-19-12-24-14-28(22(19)31)13-17-11-15-10-16(23)8-9-18(15)25-17/h5,7-12,14,25H,3-4,6,13H2,1-2H3,(H,26,29)/b7-5+ |
| InChIKey | IKOAVVIJNWQOSO-FNORWQNLSA-N |
| XLogP | 2.67 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|