C39H23N5S — CID 146367503
2-[3-(4-dibenzothiophen-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline (PubChem CID 146367503) has the molecular formula C39H23N5S and a molecular weight of 593.72 g/mol. Its IUPAC name is 2-[3-(4-dibenzothiophen-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 2-[3-(4-dibenzothiophen-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 146367503 |
| Molecular Formula | C39H23N5S |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 2-[3-(4-dibenzothiophen-3-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2nc(-c3cccc(-c4ccc5ccc6cccnc6c5n4)c3)nc(-c3ccc4c(c3)sc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C39H23N5S/c1-2-8-26(9-3-1)37-42-38(44-39(43-37)29-17-19-31-30-13-4-5-14-33(30)45-34(31)23-29)28-11-6-10-27(22-28)32-20-18-25-16-15-24-12-7-21-40-35(24)36(25)41-32/h1-23H |
| InChIKey | SWYIUJHLOZUSRJ-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|