C19H17NO3 — CID 146368894
1-[3-ethynyl-4,5-bis(prop-2-ynoxy)phenyl]-2-(prop-2-ynylamino)ethanol (PubChem CID 146368894) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[3-ethynyl-4,5-bis(prop-2-ynoxy)phenyl]-2-(prop-2-ynylamino)ethanol.
| Compound Name | 1-[3-ethynyl-4,5-bis(prop-2-ynoxy)phenyl]-2-(prop-2-ynylamino)ethanol |
|---|---|
| PubChem CID | 146368894 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[3-ethynyl-4,5-bis(prop-2-ynoxy)phenyl]-2-(prop-2-ynylamino)ethanol |
| SMILES | C#CCNCC(O)c1cc(C#C)c(OCC#C)c(OCC#C)c1 |
| InChI | InChI=1S/C19H17NO3/c1-5-9-20-14-17(21)16-12-15(8-4)19(23-11-7-3)18(13-16)22-10-6-2/h1-4,12-13,17,20-21H,9-11,14H2 |
| InChIKey | PMALNYAIEWROPB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|