C15H17NO2 — CID 146368995
N-[2-(2-ethynyl-4,5-dimethoxyphenyl)ethyl]prop-2-yn-1-amine (PubChem CID 146368995) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[2-(2-ethynyl-4,5-dimethoxyphenyl)ethyl]prop-2-yn-1-amine.
| Compound Name | N-[2-(2-ethynyl-4,5-dimethoxyphenyl)ethyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 146368995 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-[2-(2-ethynyl-4,5-dimethoxyphenyl)ethyl]prop-2-yn-1-amine |
| SMILES | C#CCNCCc1cc(OC)c(OC)cc1C#C |
| InChI | InChI=1S/C15H17NO2/c1-5-8-16-9-7-13-11-15(18-4)14(17-3)10-12(13)6-2/h1-2,10-11,16H,7-9H2,3-4H3 |
| InChIKey | HYKQYWWYINXBED-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|