C21H21ClN6O — CID 146370803
N-[(5-chloro-2-pyridinyl)methyl]-3-[(diaminomethylideneamino)methyl]-5-(2-methyl-4-pyridinyl)benzamide (PubChem CID 146370803) has the molecular formula C21H21ClN6O and a molecular weight of 408.89 g/mol. Its IUPAC name is N-[(5-chloro-2-pyridinyl)methyl]-3-[(diaminomethylideneamino)methyl]-5-(2-methyl-4-pyridinyl)benzamide.
| Compound Name | N-[(5-chloro-2-pyridinyl)methyl]-3-[(diaminomethylideneamino)methyl]-5-(2-methyl-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 146370803 |
| Molecular Formula | C21H21ClN6O |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[(5-chloro-2-pyridinyl)methyl]-3-[(diaminomethylideneamino)methyl]-5-(2-methyl-4-pyridinyl)benzamide |
| SMILES | Cc1cc(-c2cc(CN=C(N)N)cc(C(=O)NCc3ccc(Cl)cn3)c2)ccn1 |
| InChI | InChI=1S/C21H21ClN6O/c1-13-6-15(4-5-25-13)16-7-14(10-28-21(23)24)8-17(9-16)20(29)27-12-19-3-2-18(22)11-26-19/h2-9,11H,10,12H2,1H3,(H,27,29)(H4,23,24,28) |
| InChIKey | GRRHOFOENKFPNM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|