C15H15ClN4OS — CID 146371598
2-(1-amino-2-methylpropyl)-6-(2-chloro-4-pyridinyl)-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 146371598) has the molecular formula C15H15ClN4OS and a molecular weight of 334.83 g/mol. Its IUPAC name is 2-(1-amino-2-methylpropyl)-6-(2-chloro-4-pyridinyl)-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(1-amino-2-methylpropyl)-6-(2-chloro-4-pyridinyl)-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 146371598 |
| Molecular Formula | C15H15ClN4OS |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-(1-amino-2-methylpropyl)-6-(2-chloro-4-pyridinyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CC(C)C(N)c1nc2cc(-c3ccnc(Cl)c3)sc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H15ClN4OS/c1-7(2)12(17)14-19-9-6-10(22-13(9)15(21)20-14)8-3-4-18-11(16)5-8/h3-7,12H,17H2,1-2H3,(H,19,20,21) |
| InChIKey | RNOVPZFKWOWKKH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|