C8H9BrF2N2O — CID 146372327
5-bromo-3-(difluoromethoxy)-2-N-methylbenzene-1,2-diamine (PubChem CID 146372327) has the molecular formula C8H9BrF2N2O and a molecular weight of 267.07 g/mol. Its IUPAC name is 5-bromo-3-(difluoromethoxy)-2-N-methylbenzene-1,2-diamine.
| Compound Name | 5-bromo-3-(difluoromethoxy)-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 146372327 |
| Molecular Formula | C8H9BrF2N2O |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 5-bromo-3-(difluoromethoxy)-2-N-methylbenzene-1,2-diamine |
| SMILES | CNc1c(N)cc(Br)cc1OC(F)F |
| InChI | InChI=1S/C8H9BrF2N2O/c1-13-7-5(12)2-4(9)3-6(7)14-8(10)11/h2-3,8,13H,12H2,1H3 |
| InChIKey | OCXSAXMNXBDRGO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|