C9H10BrFN2O — CID 126673769
8-bromo-7-fluoro-2,3,4,5-tetrahydro-1,5-benzoxazepin-6-amine (PubChem CID 126673769) has the molecular formula C9H10BrFN2O and a molecular weight of 261.09 g/mol. Its IUPAC name is 8-bromo-7-fluoro-2,3,4,5-tetrahydro-1,5-benzoxazepin-6-amine.
| Compound Name | 8-bromo-7-fluoro-2,3,4,5-tetrahydro-1,5-benzoxazepin-6-amine |
|---|---|
| PubChem CID | 126673769 |
| Molecular Formula | C9H10BrFN2O |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 8-bromo-7-fluoro-2,3,4,5-tetrahydro-1,5-benzoxazepin-6-amine |
| SMILES | Nc1c(F)c(Br)cc2c1NCCCO2 |
| InChI | InChI=1S/C9H10BrFN2O/c10-5-4-6-9(8(12)7(5)11)13-2-1-3-14-6/h4,13H,1-3,12H2 |
| InChIKey | FAHYSBWVZUBYLW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|