C10H15BrFN3O — CID 156868293
4-bromo-6-[2-(dimethylamino)ethoxy]-3-fluorobenzene-1,2-diamine (PubChem CID 156868293) has the molecular formula C10H15BrFN3O and a molecular weight of 292.15 g/mol. Its IUPAC name is 4-bromo-6-[2-(dimethylamino)ethoxy]-3-fluorobenzene-1,2-diamine.
| Compound Name | 4-bromo-6-[2-(dimethylamino)ethoxy]-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 156868293 |
| Molecular Formula | C10H15BrFN3O |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-bromo-6-[2-(dimethylamino)ethoxy]-3-fluorobenzene-1,2-diamine |
| SMILES | CN(C)CCOc1cc(Br)c(F)c(N)c1N |
| InChI | InChI=1S/C10H15BrFN3O/c1-15(2)3-4-16-7-5-6(11)8(12)10(14)9(7)13/h5H,3-4,13-14H2,1-2H3 |
| InChIKey | BXKOYWVBDHNWSV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|