C13H20BrFN2O3 — CID 126673823
4-bromo-6-(3,3-diethoxypropoxy)-3-fluorobenzene-1,2-diamine (PubChem CID 126673823) has the molecular formula C13H20BrFN2O3 and a molecular weight of 351.22 g/mol. Its IUPAC name is 4-bromo-6-(3,3-diethoxypropoxy)-3-fluorobenzene-1,2-diamine.
| Compound Name | 4-bromo-6-(3,3-diethoxypropoxy)-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 126673823 |
| Molecular Formula | C13H20BrFN2O3 |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 4-bromo-6-(3,3-diethoxypropoxy)-3-fluorobenzene-1,2-diamine |
| SMILES | CCOC(CCOc1cc(Br)c(F)c(N)c1N)OCC |
| InChI | InChI=1S/C13H20BrFN2O3/c1-3-18-10(19-4-2)5-6-20-9-7-8(14)11(15)13(17)12(9)16/h7,10H,3-6,16-17H2,1-2H3 |
| InChIKey | NLXYWDCKVINVFY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|