C7H8BrFN2O — CID 163251693
4-bromo-6-fluoro-3-methoxybenzene-1,2-diamine (PubChem CID 163251693) has the molecular formula C7H8BrFN2O and a molecular weight of 235.06 g/mol. Its IUPAC name is 4-bromo-6-fluoro-3-methoxybenzene-1,2-diamine.
| Compound Name | 4-bromo-6-fluoro-3-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 163251693 |
| Molecular Formula | C7H8BrFN2O |
| Molecular Weight | 235.06 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 4-bromo-6-fluoro-3-methoxybenzene-1,2-diamine |
| SMILES | COc1c(Br)cc(F)c(N)c1N |
| InChI | InChI=1S/C7H8BrFN2O/c1-12-7-3(8)2-4(9)5(10)6(7)11/h2H,10-11H2,1H3 |
| InChIKey | NOLOXQVLRZFUDF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.06 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|