C12H21BrN2O2Si — CID 140775426
5-bromo-3-(2-trimethylsilylethoxymethoxy)benzene-1,2-diamine (PubChem CID 140775426) has the molecular formula C12H21BrN2O2Si and a molecular weight of 333.30 g/mol. Its IUPAC name is 5-bromo-3-(2-trimethylsilylethoxymethoxy)benzene-1,2-diamine.
| Compound Name | 5-bromo-3-(2-trimethylsilylethoxymethoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 140775426 |
| Molecular Formula | C12H21BrN2O2Si |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 5-bromo-3-(2-trimethylsilylethoxymethoxy)benzene-1,2-diamine |
| SMILES | C[Si](C)(C)CCOCOc1cc(Br)cc(N)c1N |
| InChI | InChI=1S/C12H21BrN2O2Si/c1-18(2,3)5-4-16-8-17-11-7-9(13)6-10(14)12(11)15/h6-7H,4-5,8,14-15H2,1-3H3 |
| InChIKey | SYKBXRWMIIVLDE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|