C10H9N3O2 — CID 146372520
(E)-3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)prop-2-enoic acid (PubChem CID 146372520) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is (E)-3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 146372520 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (E)-3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)prop-2-enoic acid |
| SMILES | Cc1nnc2cc(/C=C/C(=O)O)ccn12 |
| InChI | InChI=1S/C10H9N3O2/c1-7-11-12-9-6-8(2-3-10(14)15)4-5-13(7)9/h2-6H,1H3,(H,14,15)/b3-2+ |
| InChIKey | SUTLDACQAJEEIS-NSCUHMNNSA-N |
| XLogP | 1.14 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|