C18H24N2O2 — CID 146373229
(2E,4E)-5-amino-1-(4-methoxypiperidin-1-yl)-4-methyl-5-phenylpenta-2,4-dien-1-one (PubChem CID 146373229) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2E,4E)-5-amino-1-(4-methoxypiperidin-1-yl)-4-methyl-5-phenylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-amino-1-(4-methoxypiperidin-1-yl)-4-methyl-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 146373229 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2E,4E)-5-amino-1-(4-methoxypiperidin-1-yl)-4-methyl-5-phenylpenta-2,4-dien-1-one |
| SMILES | COC1CCN(C(=O)/C=C/C(C)=C(/N)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N2O2/c1-14(18(19)15-6-4-3-5-7-15)8-9-17(21)20-12-10-16(22-2)11-13-20/h3-9,16H,10-13,19H2,1-2H3/b9-8+,18-14+ |
| InChIKey | IMJGJXAIBJLXOV-HAPMQHLFSA-N |
| XLogP | 2.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|