C16H30ClN3 — CID 146377759
3-chloro-4-methyl-5-(6-methyldodecan-6-yl)-1,2,4-triazole (PubChem CID 146377759) has the molecular formula C16H30ClN3 and a molecular weight of 299.89 g/mol. Its IUPAC name is 3-chloro-4-methyl-5-(6-methyldodecan-6-yl)-1,2,4-triazole.
| Compound Name | 3-chloro-4-methyl-5-(6-methyldodecan-6-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 146377759 |
| Molecular Formula | C16H30ClN3 |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 3-chloro-4-methyl-5-(6-methyldodecan-6-yl)-1,2,4-triazole |
| SMILES | CCCCCCC(C)(CCCCC)c1nnc(Cl)n1C |
| InChI | InChI=1S/C16H30ClN3/c1-5-7-9-11-13-16(3,12-10-8-6-2)14-18-19-15(17)20(14)4/h5-13H2,1-4H3 |
| InChIKey | UBWWYMNFTVYOEK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|