C17H29F2N — CID 146377794
2,5-difluoro-3-(6-methyldodecan-6-yl)-1H-pyrrole (PubChem CID 146377794) has the molecular formula C17H29F2N and a molecular weight of 285.42 g/mol. Its IUPAC name is 2,5-difluoro-3-(6-methyldodecan-6-yl)-1H-pyrrole.
| Compound Name | 2,5-difluoro-3-(6-methyldodecan-6-yl)-1H-pyrrole |
|---|---|
| PubChem CID | 146377794 |
| Molecular Formula | C17H29F2N |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 2,5-difluoro-3-(6-methyldodecan-6-yl)-1H-pyrrole |
| SMILES | CCCCCCC(C)(CCCCC)c1cc(F)[nH]c1F |
| InChI | InChI=1S/C17H29F2N/c1-4-6-8-10-12-17(3,11-9-7-5-2)14-13-15(18)20-16(14)19/h13,20H,4-12H2,1-3H3 |
| InChIKey | XSHDOMWNBVULSQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|