C17H26Br2 — CID 134536089
2,4-dibromo-1-(5-methyldecan-5-yl)benzene (PubChem CID 134536089) has the molecular formula C17H26Br2 and a molecular weight of 390.20 g/mol. Its IUPAC name is 2,4-dibromo-1-(5-methyldecan-5-yl)benzene.
| Compound Name | 2,4-dibromo-1-(5-methyldecan-5-yl)benzene |
|---|---|
| PubChem CID | 134536089 |
| Molecular Formula | C17H26Br2 |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2,4-dibromo-1-(5-methyldecan-5-yl)benzene |
| SMILES | CCCCCC(C)(CCCC)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C17H26Br2/c1-4-6-8-12-17(3,11-7-5-2)15-10-9-14(18)13-16(15)19/h9-10,13H,4-8,11-12H2,1-3H3 |
| InChIKey | AZUDFSYOBANGHA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|