C15H23BrClN — CID 82779733
2-(4-bromo-2-chlorophenyl)nonan-2-amine (PubChem CID 82779733) has the molecular formula C15H23BrClN and a molecular weight of 332.71 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)nonan-2-amine.
| Compound Name | 2-(4-bromo-2-chlorophenyl)nonan-2-amine |
|---|---|
| PubChem CID | 82779733 |
| Molecular Formula | C15H23BrClN |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)nonan-2-amine |
| SMILES | CCCCCCCC(C)(N)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H23BrClN/c1-3-4-5-6-7-10-15(2,18)13-9-8-12(16)11-14(13)17/h8-9,11H,3-7,10,18H2,1-2H3 |
| InChIKey | WXHPGNGDGISNLD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|