C8H18Cl2N2 — CID 146380468
8-ethyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride (PubChem CID 146380468) has the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. Its IUPAC name is 8-ethyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride.
| Compound Name | 8-ethyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride |
|---|---|
| PubChem CID | 146380468 |
| Molecular Formula | C8H18Cl2N2 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 8-ethyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride |
| SMILES | CCN1C2CCC1CNC2.Cl.Cl |
| InChI | InChI=1S/C8H16N2.2ClH/c1-2-10-7-3-4-8(10)6-9-5-7;;/h7-9H,2-6H2,1H3;2*1H |
| InChIKey | PUJRTSDUBXJDJU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |