About 3,8-Diazabicyclo(3.2.1)octane dihydrochloride
3,8-Diazabicyclo(3.2.1)octane dihydrochloride (PubChem CID 22647870) has the molecular formula C6H14Cl2N2
and a molecular weight of 185.09 g/mol. Its IUPAC name is 3,8-diazabicyclo[3.2.1]octane;dihydrochloride.
Analyze 3,8-Diazabicyclo(3.2.1)octane dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-Diazabicyclo(3.2.1)octane dihydrochloride?
The IUPAC name of 3,8-Diazabicyclo(3.2.1)octane dihydrochloride (CID 22647870) is 3,8-diazabicyclo[3.2.1]octane;dihydrochloride.
What is the SMILES notation for 3,8-Diazabicyclo(3.2.1)octane dihydrochloride?
The canonical SMILES for 3,8-Diazabicyclo(3.2.1)octane dihydrochloride is C1CC2CNCC1N2.Cl.Cl.
What is the InChIKey of 3,8-Diazabicyclo(3.2.1)octane dihydrochloride?
The InChIKey is QQZDECZROKFYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.2ClH/c1-2-6-4-7-3-5(1)8-6;;/h5-8H,1-4H2;2*1H.
What are the key properties of 3,8-Diazabicyclo(3.2.1)octane dihydrochloride?
3,8-Diazabicyclo(3.2.1)octane dihydrochloride has a molecular weight of 185.09 g/mol, XLogP of not available, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-Diazabicyclo(3.2.1)octane dihydrochloride is sourced from PubChem (CID 22647870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).