C6H14Cl2N2 — CID 22647870
3,8-diazabicyclo[3.2.1]octane;dihydrochloride (PubChem CID 22647870) has the molecular formula C6H14Cl2N2 and a molecular weight of 185.10 g/mol. Its IUPAC name is 3,8-diazabicyclo[3.2.1]octane;dihydrochloride.
| Compound Name | 3,8-diazabicyclo[3.2.1]octane;dihydrochloride |
|---|---|
| PubChem CID | 22647870 |
| Molecular Formula | C6H14Cl2N2 |
| Molecular Weight | 185.10 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 3,8-diazabicyclo[3.2.1]octane;dihydrochloride |
| SMILES | C1CC2CNCC1N2.Cl.Cl |
| InChI | InChI=1S/C6H12N2.2ClH/c1-2-6-4-7-3-5(1)8-6;;/h5-8H,1-4H2;2*1H |
| InChIKey | QQZDECZROKFYDQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.10 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |