About 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride
6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride (PubChem CID 146675322) has the molecular formula C7H16Cl2N2
and a molecular weight of 199.12 g/mol. Its IUPAC name is 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride.
Analyze 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride?
The IUPAC name of 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride (CID 146675322) is 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride.
What is the SMILES notation for 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride?
The canonical SMILES for 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride is CN1CC2CC1CCN2.Cl.Cl.
What is the InChIKey of 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride?
The InChIKey is PCIHBZYZYBQSPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.2ClH/c1-9-5-6-4-7(9)2-3-8-6;;/h6-8H,2-5H2,1H3;2*1H.
What are the key properties of 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride?
6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride has a molecular weight of 199.12 g/mol, XLogP of 0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,6-diazabicyclo[3.2.1]octane;dihydrochloride is sourced from PubChem (CID 146675322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).