C21H21F3N6O4 — CID 146381517
methyl 2-[4-[3-(6-formamido-2-pyridinyl)-1,2,4-triazol-4-yl]pentoxy]-5-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 146381517) has the molecular formula C21H21F3N6O4 and a molecular weight of 478.43 g/mol. Its IUPAC name is methyl 2-[4-[3-(6-formamido-2-pyridinyl)-1,2,4-triazol-4-yl]pentoxy]-5-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-[4-[3-(6-formamido-2-pyridinyl)-1,2,4-triazol-4-yl]pentoxy]-5-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 146381517 |
| Molecular Formula | C21H21F3N6O4 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | methyl 2-[4-[3-(6-formamido-2-pyridinyl)-1,2,4-triazol-4-yl]pentoxy]-5-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C(F)(F)F)cnc1OCCCC(C)n1cnnc1-c1cccc(NC=O)n1 |
| InChI | InChI=1S/C21H21F3N6O4/c1-13(30-11-27-29-18(30)16-6-3-7-17(28-16)26-12-31)5-4-8-34-19-15(20(32)33-2)9-14(10-25-19)21(22,23)24/h3,6-7,9-13H,4-5,8H2,1-2H3,(H,26,28,31) |
| InChIKey | IHYPGNRHGHLDJK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|