C19H24N6O — CID 146382487
(3R)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(4-cyclopropylpyrimidin-2-yl)pyrrolidine-3-carboxamide (PubChem CID 146382487) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is (3R)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(4-cyclopropylpyrimidin-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(4-cyclopropylpyrimidin-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 146382487 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (3R)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(4-cyclopropylpyrimidin-2-yl)pyrrolidine-3-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)[C@@H]1CCN(c3nccc(C4CC4)n3)C1)C2 |
| InChI | InChI=1S/C19H24N6O/c20-11-25-14-3-4-17(25)16(9-14)22-18(26)13-6-8-24(10-13)19-21-7-5-15(23-19)12-1-2-12/h5,7,12-14,16-17H,1-4,6,8-10H2,(H,22,26)/t13-,14+,16-,17-/m1/s1 |
| InChIKey | KIIWGJKTHQHMRY-YALNPMBYSA-N |
| XLogP | 1.38 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|