C7H9Cl2N — CID 146384765
2,6-dichloro-1,3-dimethyl-2H-pyridine (PubChem CID 146384765) has the molecular formula C7H9Cl2N and a molecular weight of 178.06 g/mol. Its IUPAC name is 2,6-dichloro-1,3-dimethyl-2H-pyridine.
| Compound Name | 2,6-dichloro-1,3-dimethyl-2H-pyridine |
|---|---|
| PubChem CID | 146384765 |
| Molecular Formula | C7H9Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 2,6-dichloro-1,3-dimethyl-2H-pyridine |
| SMILES | CC1=CC=C(Cl)N(C)C1Cl |
| InChI | InChI=1S/C7H9Cl2N/c1-5-3-4-6(8)10(2)7(5)9/h3-4,7H,1-2H3 |
| InChIKey | YINVCYWQQKQOBG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|