C18H22N2O4S — CID 146385262
2-[4-[(4-ethoxyphenyl)methylamino]-N-methylanilino]sulfanyloxyacetic acid (PubChem CID 146385262) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[4-[(4-ethoxyphenyl)methylamino]-N-methylanilino]sulfanyloxyacetic acid.
| Compound Name | 2-[4-[(4-ethoxyphenyl)methylamino]-N-methylanilino]sulfanyloxyacetic acid |
|---|---|
| PubChem CID | 146385262 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[4-[(4-ethoxyphenyl)methylamino]-N-methylanilino]sulfanyloxyacetic acid |
| SMILES | CCOc1ccc(CNc2ccc(N(C)SOCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-3-23-17-10-4-14(5-11-17)12-19-15-6-8-16(9-7-15)20(2)25-24-13-18(21)22/h4-11,19H,3,12-13H2,1-2H3,(H,21,22) |
| InChIKey | BFEIEEBNZAXJBZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|