About 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride
1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride (PubChem CID 175521393) has the molecular formula C17H19Cl2NO4S
and a molecular weight of 404.32 g/mol. Its IUPAC name is 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride.
Molecular Properties
| Compound Name | 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride |
| PubChem CID | 175521393 |
| Molecular Formula | C17H19Cl2NO4S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride |
| SMILES | CCOc1ccc(NCc2ccc(C(C)=O)cc2)cc1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C17H19NO2.Cl2O2S/c1-3-20-17-10-8-16(9-11-17)18-12-14-4-6-15(7-5-14)13(2)19;1-5(2,3)4/h4-11,18H,3,12H2,1-2H3; |
| InChIKey | DESNUOWIQXTFHH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride?
The IUPAC name of 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride (CID 175521393) is 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride.
What is the SMILES notation for 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride?
The canonical SMILES for 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride is CCOc1ccc(NCc2ccc(C(C)=O)cc2)cc1.O=S(=O)(Cl)Cl.
What is the InChIKey of 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride?
The InChIKey is DESNUOWIQXTFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2.Cl2O2S/c1-3-20-17-10-8-16(9-11-17)18-12-14-4-6-15(7-5-14)13(2)19;1-5(2,3)4/h4-11,18H,3,12H2,1-2H3;.
What are the key properties of 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride?
1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride has a molecular weight of 404.32 g/mol, XLogP of 4.61, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(4-ethoxyanilino)methyl]phenyl]ethanone;sulfuryl dichloride is sourced from PubChem (CID 175521393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).