C19H19N7O3 — CID 146386451
3-amino-N-(2-methoxyethyl)-6-(3-methylimidazo[1,2-a]pyridin-6-yl)-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide (PubChem CID 146386451) has the molecular formula C19H19N7O3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-amino-N-(2-methoxyethyl)-6-(3-methylimidazo[1,2-a]pyridin-6-yl)-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-(2-methoxyethyl)-6-(3-methylimidazo[1,2-a]pyridin-6-yl)-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 146386451 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-amino-N-(2-methoxyethyl)-6-(3-methylimidazo[1,2-a]pyridin-6-yl)-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide |
| SMILES | COCCNC(=O)c1nc(-c2ccc3ncc(C)n3c2)c(-c2ncco2)nc1N |
| InChI | InChI=1S/C19H19N7O3/c1-11-9-23-13-4-3-12(10-26(11)13)14-15(19-22-6-8-29-19)25-17(20)16(24-14)18(27)21-5-7-28-2/h3-4,6,8-10H,5,7H2,1-2H3,(H2,20,25)(H,21,27) |
| InChIKey | IAFLBSRGRKIYEQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|