C15H15F3N4O — CID 146388285
2-[4,4-difluoro-2-(3-fluorophenyl)pyrrolidin-1-yl]-N-methoxypyrimidin-5-amine (PubChem CID 146388285) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-[4,4-difluoro-2-(3-fluorophenyl)pyrrolidin-1-yl]-N-methoxypyrimidin-5-amine.
| Compound Name | 2-[4,4-difluoro-2-(3-fluorophenyl)pyrrolidin-1-yl]-N-methoxypyrimidin-5-amine |
|---|---|
| PubChem CID | 146388285 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-[4,4-difluoro-2-(3-fluorophenyl)pyrrolidin-1-yl]-N-methoxypyrimidin-5-amine |
| SMILES | CONc1cnc(N2CC(F)(F)CC2c2cccc(F)c2)nc1 |
| InChI | InChI=1S/C15H15F3N4O/c1-23-21-12-7-19-14(20-8-12)22-9-15(17,18)6-13(22)10-3-2-4-11(16)5-10/h2-5,7-8,13,21H,6,9H2,1H3 |
| InChIKey | NEZOALZWNGGPBH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|