C46H30N6 — CID 146390366
14-[3-(4,6-diphenylpyrimidin-2-yl)-5-pyridin-2-ylphenyl]-1,14,16-triazapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2,4,6,8,10,12,15,17,19,21-decaene (PubChem CID 146390366) has the molecular formula C46H30N6 and a molecular weight of 666.79 g/mol. Its IUPAC name is 14-[3-(4,6-diphenylpyrimidin-2-yl)-5-pyridin-2-ylphenyl]-1,14,16-triazapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2,4,6,8,10,12,15,17,19,21-decaene.
| Compound Name | 14-[3-(4,6-diphenylpyrimidin-2-yl)-5-pyridin-2-ylphenyl]-1,14,16-triazapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2,4,6,8,10,12,15,17,19,21-decaene |
|---|---|
| PubChem CID | 146390366 |
| Molecular Formula | C46H30N6 |
| Molecular Weight | 666.79 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | 14-[3-(4,6-diphenylpyrimidin-2-yl)-5-pyridin-2-ylphenyl]-1,14,16-triazapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2,4,6,8,10,12,15,17,19,21-decaene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cc(-c4ccccn4)cc(N4c5ccccc5-c5ccccc5-n5c4nc4ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C46H30N6/c1-3-15-31(16-4-1)40-30-41(32-17-5-2-6-18-32)49-45(48-40)34-27-33(38-21-13-14-26-47-38)28-35(29-34)51-42-23-10-7-19-36(42)37-20-8-11-24-43(37)52-44-25-12-9-22-39(44)50-46(51)52/h1-30H |
| InChIKey | SIDKJIXQULMCNV-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.79 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |