C10H11ClN2 — CID 14639161
2-[(3-chlorophenyl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 14639161) has the molecular formula C10H11ClN2 and a molecular weight of 194.67 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[(3-chlorophenyl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 14639161 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.67 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | Clc1cccc(CC2=NCCN2)c1 |
| InChI | InChI=1S/C10H11ClN2/c11-9-3-1-2-8(6-9)7-10-12-4-5-13-10/h1-3,6H,4-5,7H2,(H,12,13) |
| InChIKey | SUUAYHCRXKJUIK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |