C9H18N2 — CID 146392588
1,2,3-trimethyl-5-propan-2-yl-3H-pyrazole (PubChem CID 146392588) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1,2,3-trimethyl-5-propan-2-yl-3H-pyrazole.
| Compound Name | 1,2,3-trimethyl-5-propan-2-yl-3H-pyrazole |
|---|---|
| PubChem CID | 146392588 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1,2,3-trimethyl-5-propan-2-yl-3H-pyrazole |
| SMILES | CC(C)C1=CC(C)N(C)N1C |
| InChI | InChI=1S/C9H18N2/c1-7(2)9-6-8(3)10(4)11(9)5/h6-8H,1-5H3 |
| InChIKey | BKJSFQAOPXLJKU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |