C15H29N3O3S — CID 146393563
4-methylsulfonyl-N-(4-propan-2-ylcyclohexyl)piperazine-1-carboxamide (PubChem CID 146393563) has the molecular formula C15H29N3O3S and a molecular weight of 331.48 g/mol. Its IUPAC name is 4-methylsulfonyl-N-(4-propan-2-ylcyclohexyl)piperazine-1-carboxamide.
| Compound Name | 4-methylsulfonyl-N-(4-propan-2-ylcyclohexyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 146393563 |
| Molecular Formula | C15H29N3O3S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 4-methylsulfonyl-N-(4-propan-2-ylcyclohexyl)piperazine-1-carboxamide |
| SMILES | CC(C)C1CCC(NC(=O)N2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C15H29N3O3S/c1-12(2)13-4-6-14(7-5-13)16-15(19)17-8-10-18(11-9-17)22(3,20)21/h12-14H,4-11H2,1-3H3,(H,16,19) |
| InChIKey | AJUZXQNVMYLDPM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |