C13H26N2O2S — CID 153459202
2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-(4-propan-2-ylcyclohexyl)acetamide (PubChem CID 153459202) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-(4-propan-2-ylcyclohexyl)acetamide.
| Compound Name | 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-(4-propan-2-ylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 153459202 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-N-(4-propan-2-ylcyclohexyl)acetamide |
| SMILES | CC(C)C1CCC(NC(=O)CN=S(C)(C)=O)CC1 |
| InChI | InChI=1S/C13H26N2O2S/c1-10(2)11-5-7-12(8-6-11)15-13(16)9-14-18(3,4)17/h10-12H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | NAWAKADAYWCMIN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |