C22H30FN5O2 — CID 146395114
N-[(1R,3R)-3-[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]cyclohexyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 146395114) has the molecular formula C22H30FN5O2 and a molecular weight of 415.51 g/mol. Its IUPAC name is N-[(1R,3R)-3-[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]cyclohexyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,3R)-3-[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]cyclohexyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146395114 |
| Molecular Formula | C22H30FN5O2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | N-[(1R,3R)-3-[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]cyclohexyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(F)c2c1NC(C(=O)N[C@@H]1CCC[C@@H](N3CCN4C(=O)NC[C@@H]4C3)C1)C2 |
| InChI | InChI=1S/C22H30FN5O2/c1-13-5-6-18(23)17-10-19(26-20(13)17)21(29)25-14-3-2-4-15(9-14)27-7-8-28-16(12-27)11-24-22(28)30/h5-6,14-16,19,26H,2-4,7-12H2,1H3,(H,24,30)(H,25,29)/t14-,15-,16-,19?/m1/s1 |
| InChIKey | BABHZGVBILFTJL-OJEBHDCCSA-N |
| XLogP | 1.61 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |