C24H33FN4O2 — CID 146395233
N-[(1R,3S)-3-[(3aR,6aR)-4-acetyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 146395233) has the molecular formula C24H33FN4O2 and a molecular weight of 428.55 g/mol. Its IUPAC name is N-[(1R,3S)-3-[(3aR,6aR)-4-acetyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,3S)-3-[(3aR,6aR)-4-acetyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146395233 |
| Molecular Formula | C24H33FN4O2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-[(1R,3S)-3-[(3aR,6aR)-4-acetyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | CC(=O)N1CC[C@@H]2[C@H]1CCN2[C@H]1CCC[C@@H](NC(=O)C2Cc3c(F)ccc(C)c3N2)C1 |
| InChI | InChI=1S/C24H33FN4O2/c1-14-6-7-19(25)18-13-20(27-23(14)18)24(31)26-16-4-3-5-17(12-16)29-11-9-21-22(29)8-10-28(21)15(2)30/h6-7,16-17,20-22,27H,3-5,8-13H2,1-2H3,(H,26,31)/t16-,17+,20?,21-,22-/m1/s1 |
| InChIKey | LLMHOKZBLMJSMH-KRIBNVRPSA-N |
| XLogP | 2.59 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |