C24H26F2N4O2 — CID 146395435
N-[3-(4-acetyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl)-5-fluorophenyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 146395435) has the molecular formula C24H26F2N4O2 and a molecular weight of 440.49 g/mol. Its IUPAC name is N-[3-(4-acetyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl)-5-fluorophenyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-(4-acetyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl)-5-fluorophenyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146395435 |
| Molecular Formula | C24H26F2N4O2 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-[3-(4-acetyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl)-5-fluorophenyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | CC(=O)N1CCC2C1CCN2c1cc(F)cc(NC(=O)C2Cc3c(F)ccc(C)c3N2)c1 |
| InChI | InChI=1S/C24H26F2N4O2/c1-13-3-4-19(26)18-12-20(28-23(13)18)24(32)27-16-9-15(25)10-17(11-16)30-8-6-21-22(30)5-7-29(21)14(2)31/h3-4,9-11,20-22,28H,5-8,12H2,1-2H3,(H,27,32) |
| InChIKey | BBRDMQUZOMQSFN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |