C13H22N2 — CID 146396237
N-[(1Z,3Z)-2-propan-2-yl-1-pyrrolidin-1-ylpenta-1,3-dienyl]methanimine (PubChem CID 146396237) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[(1Z,3Z)-2-propan-2-yl-1-pyrrolidin-1-ylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-2-propan-2-yl-1-pyrrolidin-1-ylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 146396237 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-[(1Z,3Z)-2-propan-2-yl-1-pyrrolidin-1-ylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C(\C=C/C)C(C)C)N1CCCC1 |
| InChI | InChI=1S/C13H22N2/c1-5-8-12(11(2)3)13(14-4)15-9-6-7-10-15/h5,8,11H,4,6-7,9-10H2,1-3H3/b8-5-,13-12- |
| InChIKey | WIIDJXHBSBENSH-JZSLDKAOSA-N |
| XLogP | 3.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|