About 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine
2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine (PubChem CID 146396869) has the molecular formula C13H18F3NO
and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine |
| PubChem CID | 146396869 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine |
| SMILES | CCCCC(OCC)(c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO/c1-3-5-9-12(18-4-2,13(14,15)16)11-8-6-7-10-17-11/h6-8,10H,3-5,9H2,1-2H3 |
| InChIKey | HYOIMPDWHLHKHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine?
The IUPAC name of 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine (CID 146396869) is 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine.
What is the SMILES notation for 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine?
The canonical SMILES for 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine is CCCCC(OCC)(c1ccccn1)C(F)(F)F.
What is the InChIKey of 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine?
The InChIKey is HYOIMPDWHLHKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3NO/c1-3-5-9-12(18-4-2,13(14,15)16)11-8-6-7-10-17-11/h6-8,10H,3-5,9H2,1-2H3.
What are the key properties of 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine?
2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine has a molecular weight of 261.29 g/mol, XLogP of 4.07, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine is sourced from PubChem (CID 146396869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).