C13H18F3NO — CID 146396869
2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine (PubChem CID 146396869) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine.
| Compound Name | 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine |
|---|---|
| PubChem CID | 146396869 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-(2-ethoxy-1,1,1-trifluorohexan-2-yl)pyridine |
| SMILES | CCCCC(OCC)(c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO/c1-3-5-9-12(18-4-2,13(14,15)16)11-8-6-7-10-17-11/h6-8,10H,3-5,9H2,1-2H3 |
| InChIKey | HYOIMPDWHLHKHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |