C13H21NO — CID 146397041
2-(2-ethoxy-3,3-dimethylbutan-2-yl)pyridine (PubChem CID 146397041) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(2-ethoxy-3,3-dimethylbutan-2-yl)pyridine.
| Compound Name | 2-(2-ethoxy-3,3-dimethylbutan-2-yl)pyridine |
|---|---|
| PubChem CID | 146397041 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-(2-ethoxy-3,3-dimethylbutan-2-yl)pyridine |
| SMILES | CCOC(C)(c1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C13H21NO/c1-6-15-13(5,12(2,3)4)11-9-7-8-10-14-11/h7-10H,6H2,1-5H3 |
| InChIKey | SCQBSHUAYHUPEB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |