C12H17N3O2S — CID 146399863
(5S,6R)-5,6-dimethyl-9λ6-thia-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene 9,9-dioxide (PubChem CID 146399863) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is (5S,6R)-5,6-dimethyl-9λ6-thia-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene 9,9-dioxide.
| Compound Name | (5S,6R)-5,6-dimethyl-9λ6-thia-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene 9,9-dioxide |
|---|---|
| PubChem CID | 146399863 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (5S,6R)-5,6-dimethyl-9λ6-thia-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene 9,9-dioxide |
| SMILES | C[C@H]1CCN2c3ncccc3S(=O)(=O)NC[C@@]12C |
| InChI | InChI=1S/C12H17N3O2S/c1-9-5-7-15-11-10(4-3-6-13-11)18(16,17)14-8-12(9,15)2/h3-4,6,9,14H,5,7-8H2,1-2H3/t9-,12-/m0/s1 |
| InChIKey | CXLWHNDVHLVNCA-CABZTGNLSA-N |
| XLogP | 0.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |