C14H19N3O5S — CID 146399881
tert-butyl 1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-azetidine]-1'-carboxylate (PubChem CID 146399881) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is tert-butyl 1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-azetidine]-1'-carboxylate.
| Compound Name | tert-butyl 1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 146399881 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | tert-butyl 1,1-dioxospiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-azetidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CNS(=O)(=O)c3cccnc3O2)C1 |
| InChI | InChI=1S/C14H19N3O5S/c1-13(2,3)22-12(18)17-8-14(9-17)7-16-23(19,20)10-5-4-6-15-11(10)21-14/h4-6,16H,7-9H2,1-3H3 |
| InChIKey | UHPJNNZPRWFAJQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |